hydrazinyl hydrogen sulfite

H4N2O3S — CID 172731105

IUPAChydrazinyl hydrogen sulfite
SMILESNNOS(=O)O
InChIInChI=1S/H4N2O3S/c1-2-5-6(3)4/h2H,1H2,(H,3,4)
InChIKeyHUNAPZNFXLZQLK-UHFFFAOYSA-N
MW112.11 g/mol
LogP-1.48
Rot. Bonds2

About hydrazinyl hydrogen sulfite

hydrazinyl hydrogen sulfite (PubChem CID 172731105) has the molecular formula H4N2O3S and a molecular weight of 112.11 g/mol. Its IUPAC name is hydrazinyl hydrogen sulfite.

Molecular Properties

Compound Namehydrazinyl hydrogen sulfite
PubChem CID172731105
Molecular FormulaH4N2O3S
Molecular Weight112.11 g/mol
Exact Mass111.99
IUPAC Namehydrazinyl hydrogen sulfite
SMILESNNOS(=O)O
InChIInChI=1S/H4N2O3S/c1-2-5-6(3)4/h2H,1H2,(H,3,4)
InChIKeyHUNAPZNFXLZQLK-UHFFFAOYSA-N
XLogP-1.48
TPSA84.58 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms6
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500112.11
LogP ≤ 5-1.48
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze hydrazinyl hydrogen sulfite with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of hydrazinyl hydrogen sulfite?
The IUPAC name of hydrazinyl hydrogen sulfite (CID 172731105) is hydrazinyl hydrogen sulfite.
What is the SMILES notation for hydrazinyl hydrogen sulfite?
The canonical SMILES for hydrazinyl hydrogen sulfite is NNOS(=O)O.
What is the InChIKey of hydrazinyl hydrogen sulfite?
The InChIKey is HUNAPZNFXLZQLK-UHFFFAOYSA-N. The full InChI is InChI=1S/H4N2O3S/c1-2-5-6(3)4/h2H,1H2,(H,3,4).
What are the key properties of hydrazinyl hydrogen sulfite?
hydrazinyl hydrogen sulfite has a molecular weight of 112.11 g/mol, XLogP of -1.48, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazinyl hydrogen sulfite is sourced from PubChem (CID 172731105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).