C15H20Cl2N2O3 — CID 172731274
4-[(3-tert-butyl-2,6-dichloro-4-pyridinyl)oxy]piperidine-1-carboxylic acid (PubChem CID 172731274) has the molecular formula C15H20Cl2N2O3 and a molecular weight of 347.24 g/mol. Its IUPAC name is 4-[(3-tert-butyl-2,6-dichloro-4-pyridinyl)oxy]piperidine-1-carboxylic acid.
| Compound Name | 4-[(3-tert-butyl-2,6-dichloro-4-pyridinyl)oxy]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 172731274 |
| Molecular Formula | C15H20Cl2N2O3 |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 4-[(3-tert-butyl-2,6-dichloro-4-pyridinyl)oxy]piperidine-1-carboxylic acid |
| SMILES | CC(C)(C)c1c(OC2CCN(C(=O)O)CC2)cc(Cl)nc1Cl |
| InChI | InChI=1S/C15H20Cl2N2O3/c1-15(2,3)12-10(8-11(16)18-13(12)17)22-9-4-6-19(7-5-9)14(20)21/h8-9H,4-7H2,1-3H3,(H,20,21) |
| InChIKey | HVBYERBCLMOZLL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|