About hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;bis(pyrimidine)
hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;bis(pyrimidine) (PubChem CID 172732059) has the molecular formula C8H10Cr2N4O7
and a molecular weight of 378.18 g/mol. Its IUPAC name is hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;bis(pyrimidine).
Molecular Properties
| Compound Name | hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;bis(pyrimidine) |
| PubChem CID | 172732059 |
| Molecular Formula | C8H10Cr2N4O7 |
| Molecular Weight | 378.18 g/mol |
| Exact Mass | 377.94 |
| IUPAC Name | hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;bis(pyrimidine) |
| SMILES | O=[Cr](=O)(O)O[Cr](=O)(=O)O.c1cncnc1.c1cncnc1 |
| InChI | InChI=1S/2C4H4N2.2Cr.2H2O.5O/c2*1-2-5-4-6-3-1;;;;;;;;;/h2*1-4H;;;2*1H2;;;;;/q;;2*+1;;;;;;;/p-2 |
| InChIKey | HXTZJKDKWRMULF-UHFFFAOYSA-L |
| XLogP | -0.71 |
| TPSA | 169.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.18 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;bis(pyrimidine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;bis(pyrimidine)?
The IUPAC name of hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;bis(pyrimidine) (CID 172732059) is hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;bis(pyrimidine).
What is the SMILES notation for hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;bis(pyrimidine)?
The canonical SMILES for hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;bis(pyrimidine) is O=[Cr](=O)(O)O[Cr](=O)(=O)O.c1cncnc1.c1cncnc1.
What is the InChIKey of hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;bis(pyrimidine)?
The InChIKey is HXTZJKDKWRMULF-UHFFFAOYSA-L. The full InChI is InChI=1S/2C4H4N2.2Cr.2H2O.5O/c2*1-2-5-4-6-3-1;;;;;;;;;/h2*1-4H;;;2*1H2;;;;;/q;;2*+1;;;;;;;/p-2.
What are the key properties of hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;bis(pyrimidine)?
hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;bis(pyrimidine) has a molecular weight of 378.18 g/mol, XLogP of -0.71, 2 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;bis(pyrimidine) is sourced from PubChem (CID 172732059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).