About dimethylsilylidenemethyl-dimethylsilyloxy-methylsilane
dimethylsilylidenemethyl-dimethylsilyloxy-methylsilane (PubChem CID 172732382) has the molecular formula C6H18OSi3
and a molecular weight of 190.47 g/mol. Its IUPAC name is dimethylsilylidenemethyl-dimethylsilyloxy-methylsilane.
Molecular Properties
| Compound Name | dimethylsilylidenemethyl-dimethylsilyloxy-methylsilane |
| PubChem CID | 172732382 |
| Molecular Formula | C6H18OSi3 |
| Molecular Weight | 190.47 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | dimethylsilylidenemethyl-dimethylsilyloxy-methylsilane |
| SMILES | C[Si](C)=C[SiH](C)O[SiH](C)C |
| InChI | InChI=1S/C6H18OSi3/c1-8(2)6-10(5)7-9(3)4/h6,9-10H,1-5H3 |
| InChIKey | HYWYDHJHLXZWNJ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.47 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethylsilylidenemethyl-dimethylsilyloxy-methylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylsilylidenemethyl-dimethylsilyloxy-methylsilane?
The IUPAC name of dimethylsilylidenemethyl-dimethylsilyloxy-methylsilane (CID 172732382) is dimethylsilylidenemethyl-dimethylsilyloxy-methylsilane.
What is the SMILES notation for dimethylsilylidenemethyl-dimethylsilyloxy-methylsilane?
The canonical SMILES for dimethylsilylidenemethyl-dimethylsilyloxy-methylsilane is C[Si](C)=C[SiH](C)O[SiH](C)C.
What is the InChIKey of dimethylsilylidenemethyl-dimethylsilyloxy-methylsilane?
The InChIKey is HYWYDHJHLXZWNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H18OSi3/c1-8(2)6-10(5)7-9(3)4/h6,9-10H,1-5H3.
What are the key properties of dimethylsilylidenemethyl-dimethylsilyloxy-methylsilane?
dimethylsilylidenemethyl-dimethylsilyloxy-methylsilane has a molecular weight of 190.47 g/mol, XLogP of 1.02, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylsilylidenemethyl-dimethylsilyloxy-methylsilane is sourced from PubChem (CID 172732382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).