C20H27N3O3 — CID 172732835
3-N-methyl-1-N-(3-methyl-2-nitrophenyl)-5-phenylmethoxypentane-1,3-diamine (PubChem CID 172732835) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is 3-N-methyl-1-N-(3-methyl-2-nitrophenyl)-5-phenylmethoxypentane-1,3-diamine.
| Compound Name | 3-N-methyl-1-N-(3-methyl-2-nitrophenyl)-5-phenylmethoxypentane-1,3-diamine |
|---|---|
| PubChem CID | 172732835 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 3-N-methyl-1-N-(3-methyl-2-nitrophenyl)-5-phenylmethoxypentane-1,3-diamine |
| SMILES | CNC(CCNc1cccc(C)c1[N+](=O)[O-])CCOCc1ccccc1 |
| InChI | InChI=1S/C20H27N3O3/c1-16-7-6-10-19(20(16)23(24)25)22-13-11-18(21-2)12-14-26-15-17-8-4-3-5-9-17/h3-10,18,21-22H,11-15H2,1-2H3 |
| InChIKey | IAISXKPMNBGJSZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|