About 4-(4-aminophenyl)-2,6-dinitroaniline;hydrochloride
4-(4-aminophenyl)-2,6-dinitroaniline;hydrochloride (PubChem CID 172733721) has the molecular formula C12H11ClN4O4
and a molecular weight of 310.70 g/mol. Its IUPAC name is 4-(4-aminophenyl)-2,6-dinitroaniline;hydrochloride.
Molecular Properties
| Compound Name | 4-(4-aminophenyl)-2,6-dinitroaniline;hydrochloride |
| PubChem CID | 172733721 |
| Molecular Formula | C12H11ClN4O4 |
| Molecular Weight | 310.70 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 4-(4-aminophenyl)-2,6-dinitroaniline;hydrochloride |
| SMILES | Cl.Nc1ccc(-c2cc([N+](=O)[O-])c(N)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C12H10N4O4.ClH/c13-9-3-1-7(2-4-9)8-5-10(15(17)18)12(14)11(6-8)16(19)20;/h1-6H,13-14H2;1H |
| InChIKey | IDIAGQOXCGUCAK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 138.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.70 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-aminophenyl)-2,6-dinitroaniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-aminophenyl)-2,6-dinitroaniline;hydrochloride?
The IUPAC name of 4-(4-aminophenyl)-2,6-dinitroaniline;hydrochloride (CID 172733721) is 4-(4-aminophenyl)-2,6-dinitroaniline;hydrochloride.
What is the SMILES notation for 4-(4-aminophenyl)-2,6-dinitroaniline;hydrochloride?
The canonical SMILES for 4-(4-aminophenyl)-2,6-dinitroaniline;hydrochloride is Cl.Nc1ccc(-c2cc([N+](=O)[O-])c(N)c([N+](=O)[O-])c2)cc1.
What is the InChIKey of 4-(4-aminophenyl)-2,6-dinitroaniline;hydrochloride?
The InChIKey is IDIAGQOXCGUCAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N4O4.ClH/c13-9-3-1-7(2-4-9)8-5-10(15(17)18)12(14)11(6-8)16(19)20;/h1-6H,13-14H2;1H.
What are the key properties of 4-(4-aminophenyl)-2,6-dinitroaniline;hydrochloride?
4-(4-aminophenyl)-2,6-dinitroaniline;hydrochloride has a molecular weight of 310.70 g/mol, XLogP of 2.76, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-aminophenyl)-2,6-dinitroaniline;hydrochloride is sourced from PubChem (CID 172733721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).