C13H14ClF3N4O3 — CID 172734308
3-[2-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-5-methyl-1,3,2-dioxazol-4-yl]-N-methylpropanamide (PubChem CID 172734308) has the molecular formula C13H14ClF3N4O3 and a molecular weight of 366.73 g/mol. Its IUPAC name is 3-[2-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-5-methyl-1,3,2-dioxazol-4-yl]-N-methylpropanamide.
| Compound Name | 3-[2-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-5-methyl-1,3,2-dioxazol-4-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 172734308 |
| Molecular Formula | C13H14ClF3N4O3 |
| Molecular Weight | 366.73 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 3-[2-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-5-methyl-1,3,2-dioxazol-4-yl]-N-methylpropanamide |
| SMILES | CNC(=O)CCC1=C(C)ON(Nc2ccc(C(F)(F)F)c(Cl)n2)O1 |
| InChI | InChI=1S/C13H14ClF3N4O3/c1-7-9(4-6-11(22)18-2)24-21(23-7)20-10-5-3-8(12(14)19-10)13(15,16)17/h3,5H,4,6H2,1-2H3,(H,18,22)(H,19,20) |
| InChIKey | IFIBIMNKJQVOQZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.73 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|