C24H32O6 — CID 172735566
3,3-bis(ethenoxy)-2-(2-phenoxyundec-1-enoxy)prop-2-enoic acid (PubChem CID 172735566) has the molecular formula C24H32O6 and a molecular weight of 416.51 g/mol. Its IUPAC name is 3,3-bis(ethenoxy)-2-(2-phenoxyundec-1-enoxy)prop-2-enoic acid.
| Compound Name | 3,3-bis(ethenoxy)-2-(2-phenoxyundec-1-enoxy)prop-2-enoic acid |
|---|---|
| PubChem CID | 172735566 |
| Molecular Formula | C24H32O6 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 3,3-bis(ethenoxy)-2-(2-phenoxyundec-1-enoxy)prop-2-enoic acid |
| SMILES | C=COC(OC=C)=C(OC=C(CCCCCCCCC)Oc1ccccc1)C(=O)O |
| InChI | InChI=1S/C24H32O6/c1-4-7-8-9-10-11-13-18-21(30-20-16-14-12-15-17-20)19-29-22(23(25)26)24(27-5-2)28-6-3/h5-6,12,14-17,19H,2-4,7-11,13,18H2,1H3,(H,25,26) |
| InChIKey | IJPLQDYLNAHUEP-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|