C14H14F2O5S — CID 172736315
[(3,4-difluorophenyl)sulfonyl-(3-oxocyclopentyl)methyl] acetate (PubChem CID 172736315) has the molecular formula C14H14F2O5S and a molecular weight of 332.32 g/mol. Its IUPAC name is [(3,4-difluorophenyl)sulfonyl-(3-oxocyclopentyl)methyl] acetate.
| Compound Name | [(3,4-difluorophenyl)sulfonyl-(3-oxocyclopentyl)methyl] acetate |
|---|---|
| PubChem CID | 172736315 |
| Molecular Formula | C14H14F2O5S |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | [(3,4-difluorophenyl)sulfonyl-(3-oxocyclopentyl)methyl] acetate |
| SMILES | CC(=O)OC(C1CCC(=O)C1)S(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H14F2O5S/c1-8(17)21-14(9-2-3-10(18)6-9)22(19,20)11-4-5-12(15)13(16)7-11/h4-5,7,9,14H,2-3,6H2,1H3 |
| InChIKey | IMIUDQOXLHAIDA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |