About 4-(1-bicyclo[2.2.1]heptanyl)-2,6-dichlorophenol
4-(1-bicyclo[2.2.1]heptanyl)-2,6-dichlorophenol (PubChem CID 172737730) has the molecular formula C13H14Cl2O
and a molecular weight of 257.16 g/mol. Its IUPAC name is 4-(1-bicyclo[2.2.1]heptanyl)-2,6-dichlorophenol.
Molecular Properties
| Compound Name | 4-(1-bicyclo[2.2.1]heptanyl)-2,6-dichlorophenol |
| PubChem CID | 172737730 |
| Molecular Formula | C13H14Cl2O |
| Molecular Weight | 257.16 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 4-(1-bicyclo[2.2.1]heptanyl)-2,6-dichlorophenol |
| SMILES | Oc1c(Cl)cc(C23CCC(CC2)C3)cc1Cl |
| InChI | InChI=1S/C13H14Cl2O/c14-10-5-9(6-11(15)12(10)16)13-3-1-8(7-13)2-4-13/h5-6,8,16H,1-4,7H2 |
| InChIKey | IRCKUMTUHDSLIU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.16 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(1-bicyclo[2.2.1]heptanyl)-2,6-dichlorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-bicyclo[2.2.1]heptanyl)-2,6-dichlorophenol?
The IUPAC name of 4-(1-bicyclo[2.2.1]heptanyl)-2,6-dichlorophenol (CID 172737730) is 4-(1-bicyclo[2.2.1]heptanyl)-2,6-dichlorophenol.
What is the SMILES notation for 4-(1-bicyclo[2.2.1]heptanyl)-2,6-dichlorophenol?
The canonical SMILES for 4-(1-bicyclo[2.2.1]heptanyl)-2,6-dichlorophenol is Oc1c(Cl)cc(C23CCC(CC2)C3)cc1Cl.
What is the InChIKey of 4-(1-bicyclo[2.2.1]heptanyl)-2,6-dichlorophenol?
The InChIKey is IRCKUMTUHDSLIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14Cl2O/c14-10-5-9(6-11(15)12(10)16)13-3-1-8(7-13)2-4-13/h5-6,8,16H,1-4,7H2.
What are the key properties of 4-(1-bicyclo[2.2.1]heptanyl)-2,6-dichlorophenol?
4-(1-bicyclo[2.2.1]heptanyl)-2,6-dichlorophenol has a molecular weight of 257.16 g/mol, XLogP of 4.53, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-bicyclo[2.2.1]heptanyl)-2,6-dichlorophenol is sourced from PubChem (CID 172737730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).