C17H23N7O5 — CID 172738007
(2R,3R,4S,5R)-2-(azidomethyl)-5-[6-(oxolan-3-yl)-7H-purin-9-ium-9-yl]oxolane-3,4-diol;prop-1-en-2-olate (PubChem CID 172738007) has the molecular formula C17H23N7O5 and a molecular weight of 405.42 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(azidomethyl)-5-[6-(oxolan-3-yl)-7H-purin-9-ium-9-yl]oxolane-3,4-diol;prop-1-en-2-olate.
| Compound Name | (2R,3R,4S,5R)-2-(azidomethyl)-5-[6-(oxolan-3-yl)-7H-purin-9-ium-9-yl]oxolane-3,4-diol;prop-1-en-2-olate |
|---|---|
| PubChem CID | 172738007 |
| Molecular Formula | C17H23N7O5 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | (2R,3R,4S,5R)-2-(azidomethyl)-5-[6-(oxolan-3-yl)-7H-purin-9-ium-9-yl]oxolane-3,4-diol;prop-1-en-2-olate |
| SMILES | C=C(C)[O-].[N-]=[N+]=NC[C@H]1O[C@@H]([n+]2c[nH]c3c(C4CCOC4)ncnc32)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H17N7O4.C3H6O/c15-20-19-3-8-11(22)12(23)14(25-8)21-6-18-10-9(7-1-2-24-4-7)16-5-17-13(10)21;1-3(2)4/h5-8,11-12,14,22-23H,1-4H2;4H,1H2,2H3/t7?,8-,11+,12+,14-;/m1./s1 |
| InChIKey | PQQQNXFPJOZLLS-AZYQFYSQSA-N |
| XLogP | -0.44 |
| TPSA | 176.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|