About N-(5-bromo-2-pyridinyl)-N-(2,4-dimethylbenzoyl)-2,4-dimethylbenzamide
N-(5-bromo-2-pyridinyl)-N-(2,4-dimethylbenzoyl)-2,4-dimethylbenzamide (PubChem CID 17273901) has the molecular formula C23H21BrN2O2
and a molecular weight of 437.34 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-N-(2,4-dimethylbenzoyl)-2,4-dimethylbenzamide.
Molecular Properties
| Compound Name | N-(5-bromo-2-pyridinyl)-N-(2,4-dimethylbenzoyl)-2,4-dimethylbenzamide |
| PubChem CID | 17273901 |
| Molecular Formula | C23H21BrN2O2 |
| Molecular Weight | 437.34 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-N-(2,4-dimethylbenzoyl)-2,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)N(C(=O)c2ccc(C)cc2C)c2ccc(Br)cn2)c(C)c1 |
| InChI | InChI=1S/C23H21BrN2O2/c1-14-5-8-19(16(3)11-14)22(27)26(21-10-7-18(24)13-25-21)23(28)20-9-6-15(2)12-17(20)4/h5-13H,1-4H3 |
| InChIKey | IWRKDAIGDNIHNU-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.34 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-(5-bromo-2-pyridinyl)-N-(2,4-dimethylbenzoyl)-2,4-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-bromo-2-pyridinyl)-N-(2,4-dimethylbenzoyl)-2,4-dimethylbenzamide?
The IUPAC name of N-(5-bromo-2-pyridinyl)-N-(2,4-dimethylbenzoyl)-2,4-dimethylbenzamide (CID 17273901) is N-(5-bromo-2-pyridinyl)-N-(2,4-dimethylbenzoyl)-2,4-dimethylbenzamide.
What is the SMILES notation for N-(5-bromo-2-pyridinyl)-N-(2,4-dimethylbenzoyl)-2,4-dimethylbenzamide?
The canonical SMILES for N-(5-bromo-2-pyridinyl)-N-(2,4-dimethylbenzoyl)-2,4-dimethylbenzamide is Cc1ccc(C(=O)N(C(=O)c2ccc(C)cc2C)c2ccc(Br)cn2)c(C)c1.
What is the InChIKey of N-(5-bromo-2-pyridinyl)-N-(2,4-dimethylbenzoyl)-2,4-dimethylbenzamide?
The InChIKey is IWRKDAIGDNIHNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21BrN2O2/c1-14-5-8-19(16(3)11-14)22(27)26(21-10-7-18(24)13-25-21)23(28)20-9-6-15(2)12-17(20)4/h5-13H,1-4H3.
What are the key properties of N-(5-bromo-2-pyridinyl)-N-(2,4-dimethylbenzoyl)-2,4-dimethylbenzamide?
N-(5-bromo-2-pyridinyl)-N-(2,4-dimethylbenzoyl)-2,4-dimethylbenzamide has a molecular weight of 437.34 g/mol, XLogP of 5.56, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-bromo-2-pyridinyl)-N-(2,4-dimethylbenzoyl)-2,4-dimethylbenzamide is sourced from PubChem (CID 17273901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).