C15H16N5OS+ — CID 172739310
N-[1-(2,6-dimethyl-4-pyridinyl)-4-methyl-1,3-thiazol-1-ium-2-yl]imidazole-1-carboxamide (PubChem CID 172739310) has the molecular formula C15H16N5OS+ and a molecular weight of 314.39 g/mol. Its IUPAC name is N-[1-(2,6-dimethyl-4-pyridinyl)-4-methyl-1,3-thiazol-1-ium-2-yl]imidazole-1-carboxamide.
| Compound Name | N-[1-(2,6-dimethyl-4-pyridinyl)-4-methyl-1,3-thiazol-1-ium-2-yl]imidazole-1-carboxamide |
|---|---|
| PubChem CID | 172739310 |
| Molecular Formula | C15H16N5OS+ |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | N-[1-(2,6-dimethyl-4-pyridinyl)-4-methyl-1,3-thiazol-1-ium-2-yl]imidazole-1-carboxamide |
| SMILES | Cc1cc(-[s+]2cc(C)nc2NC(=O)n2ccnc2)cc(C)n1 |
| InChI | InChI=1S/C15H15N5OS/c1-10-6-13(7-11(2)17-10)22-8-12(3)18-14(22)19-15(21)20-5-4-16-9-20/h4-9H,1-3H3/p+1 |
| InChIKey | IWIFQQOHJWWBOW-UHFFFAOYSA-O |
| XLogP | 3.42 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|