C19H22BFN2O4 — CID 172739391
methyl 4-[2-amino-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-2-fluorobenzoate (PubChem CID 172739391) has the molecular formula C19H22BFN2O4 and a molecular weight of 372.21 g/mol. Its IUPAC name is methyl 4-[2-amino-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-2-fluorobenzoate.
| Compound Name | methyl 4-[2-amino-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-2-fluorobenzoate |
|---|---|
| PubChem CID | 172739391 |
| Molecular Formula | C19H22BFN2O4 |
| Molecular Weight | 372.21 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | methyl 4-[2-amino-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-2-fluorobenzoate |
| SMILES | COC(=O)c1ccc(-c2c(B3OC(C)(C)C(C)(C)O3)ccnc2N)cc1F |
| InChI | InChI=1S/C19H22BFN2O4/c1-18(2)19(3,4)27-20(26-18)13-8-9-23-16(22)15(13)11-6-7-12(14(21)10-11)17(24)25-5/h6-10H,1-5H3,(H2,22,23) |
| InChIKey | IWRNDSHTWKOAGL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.21 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|