About 4-oxo-1-propylpyrido[1,2-a]pyrimidin-1-ium-3-carbaldehyde
4-oxo-1-propylpyrido[1,2-a]pyrimidin-1-ium-3-carbaldehyde (PubChem CID 172739780) has the molecular formula C12H13N2O2+
and a molecular weight of 217.25 g/mol. Its IUPAC name is 4-oxo-1-propylpyrido[1,2-a]pyrimidin-1-ium-3-carbaldehyde.
Molecular Properties
| Compound Name | 4-oxo-1-propylpyrido[1,2-a]pyrimidin-1-ium-3-carbaldehyde |
| PubChem CID | 172739780 |
| Molecular Formula | C12H13N2O2+ |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 4-oxo-1-propylpyrido[1,2-a]pyrimidin-1-ium-3-carbaldehyde |
| SMILES | CCC[n+]1cc(C=O)c(=O)n2ccccc21 |
| InChI | InChI=1S/C12H13N2O2/c1-2-6-13-8-10(9-15)12(16)14-7-4-3-5-11(13)14/h3-5,7-9H,2,6H2,1H3/q+1 |
| InChIKey | IYAZDUNMJWWMTR-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-oxo-1-propylpyrido[1,2-a]pyrimidin-1-ium-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-1-propylpyrido[1,2-a]pyrimidin-1-ium-3-carbaldehyde?
The IUPAC name of 4-oxo-1-propylpyrido[1,2-a]pyrimidin-1-ium-3-carbaldehyde (CID 172739780) is 4-oxo-1-propylpyrido[1,2-a]pyrimidin-1-ium-3-carbaldehyde.
What is the SMILES notation for 4-oxo-1-propylpyrido[1,2-a]pyrimidin-1-ium-3-carbaldehyde?
The canonical SMILES for 4-oxo-1-propylpyrido[1,2-a]pyrimidin-1-ium-3-carbaldehyde is CCC[n+]1cc(C=O)c(=O)n2ccccc21.
What is the InChIKey of 4-oxo-1-propylpyrido[1,2-a]pyrimidin-1-ium-3-carbaldehyde?
The InChIKey is IYAZDUNMJWWMTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N2O2/c1-2-6-13-8-10(9-15)12(16)14-7-4-3-5-11(13)14/h3-5,7-9H,2,6H2,1H3/q+1.
What are the key properties of 4-oxo-1-propylpyrido[1,2-a]pyrimidin-1-ium-3-carbaldehyde?
4-oxo-1-propylpyrido[1,2-a]pyrimidin-1-ium-3-carbaldehyde has a molecular weight of 217.25 g/mol, XLogP of 0.81, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-1-propylpyrido[1,2-a]pyrimidin-1-ium-3-carbaldehyde is sourced from PubChem (CID 172739780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).