C29H26N2O8 — CID 17274000
N-[3-[bis(2,6-dimethoxybenzoyl)amino]phenyl]furan-2-carboxamide (PubChem CID 17274000) has the molecular formula C29H26N2O8 and a molecular weight of 530.53 g/mol. Its IUPAC name is N-[3-[bis(2,6-dimethoxybenzoyl)amino]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[bis(2,6-dimethoxybenzoyl)amino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17274000 |
| Molecular Formula | C29H26N2O8 |
| Molecular Weight | 530.53 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | N-[3-[bis(2,6-dimethoxybenzoyl)amino]phenyl]furan-2-carboxamide |
| SMILES | COc1cccc(OC)c1C(=O)N(C(=O)c1c(OC)cccc1OC)c1cccc(NC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C29H26N2O8/c1-35-20-11-6-12-21(36-2)25(20)28(33)31(29(34)26-22(37-3)13-7-14-23(26)38-4)19-10-5-9-18(17-19)30-27(32)24-15-8-16-39-24/h5-17H,1-4H3,(H,30,32) |
| InChIKey | NSQFWWXTIGWIIJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 116.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|