C30H26Cl2F2N2O3S — CID 172740852
(E)-3-[5-[(2,4-dichlorophenyl)methyl]-2-fluoro-6,7,8,9,10,11-hexahydrocycloocta[b]indol-4-yl]-N-(4-fluorophenyl)sulfonylprop-2-enamide (PubChem CID 172740852) has the molecular formula C30H26Cl2F2N2O3S and a molecular weight of 603.52 g/mol. Its IUPAC name is (E)-3-[5-[(2,4-dichlorophenyl)methyl]-2-fluoro-6,7,8,9,10,11-hexahydrocycloocta[b]indol-4-yl]-N-(4-fluorophenyl)sulfonylprop-2-enamide.
| Compound Name | (E)-3-[5-[(2,4-dichlorophenyl)methyl]-2-fluoro-6,7,8,9,10,11-hexahydrocycloocta[b]indol-4-yl]-N-(4-fluorophenyl)sulfonylprop-2-enamide |
|---|---|
| PubChem CID | 172740852 |
| Molecular Formula | C30H26Cl2F2N2O3S |
| Molecular Weight | 603.52 g/mol |
| Exact Mass | 602.10 |
| IUPAC Name | (E)-3-[5-[(2,4-dichlorophenyl)methyl]-2-fluoro-6,7,8,9,10,11-hexahydrocycloocta[b]indol-4-yl]-N-(4-fluorophenyl)sulfonylprop-2-enamide |
| SMILES | O=C(/C=C/c1cc(F)cc2c3c(n(Cc4ccc(Cl)cc4Cl)c12)CCCCCC3)NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C30H26Cl2F2N2O3S/c31-21-9-7-20(27(32)16-21)18-36-28-6-4-2-1-3-5-25(28)26-17-23(34)15-19(30(26)36)8-14-29(37)35-40(38,39)24-12-10-22(33)11-13-24/h7-17H,1-6,18H2,(H,35,37)/b14-8+ |
| InChIKey | JBSDLKTWNNTUCZ-RIYZIHGNSA-N |
| XLogP | 7.45 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.52 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|