C31H44ClN3O6S2 — CID 172740872
3-[[4-[2-(acetylsulfamoyl)phenyl]-3-chlorophenyl]methylamino]-N-[(2R)-2-cyclohexyl-2-sulfanylethyl]propanamide;pentanoic acid (PubChem CID 172740872) has the molecular formula C31H44ClN3O6S2 and a molecular weight of 654.30 g/mol. Its IUPAC name is 3-[[4-[2-(acetylsulfamoyl)phenyl]-3-chlorophenyl]methylamino]-N-[(2R)-2-cyclohexyl-2-sulfanylethyl]propanamide;pentanoic acid.
| Compound Name | 3-[[4-[2-(acetylsulfamoyl)phenyl]-3-chlorophenyl]methylamino]-N-[(2R)-2-cyclohexyl-2-sulfanylethyl]propanamide;pentanoic acid |
|---|---|
| PubChem CID | 172740872 |
| Molecular Formula | C31H44ClN3O6S2 |
| Molecular Weight | 654.30 g/mol |
| Exact Mass | 653.24 |
| IUPAC Name | 3-[[4-[2-(acetylsulfamoyl)phenyl]-3-chlorophenyl]methylamino]-N-[(2R)-2-cyclohexyl-2-sulfanylethyl]propanamide;pentanoic acid |
| SMILES | CC(=O)NS(=O)(=O)c1ccccc1-c1ccc(CNCCC(=O)NC[C@H](S)C2CCCCC2)cc1Cl.CCCCC(=O)O |
| InChI | InChI=1S/C26H34ClN3O4S2.C5H10O2/c1-18(31)30-36(33,34)25-10-6-5-9-22(25)21-12-11-19(15-23(21)27)16-28-14-13-26(32)29-17-24(35)20-7-3-2-4-8-20;1-2-3-4-5(6)7/h5-6,9-12,15,20,24,28,35H,2-4,7-8,13-14,16-17H2,1H3,(H,29,32)(H,30,31);2-4H2,1H3,(H,6,7)/t24-;/m0./s1 |
| InChIKey | JBTPEZWHRJTCTQ-JIDHJSLPSA-N |
| XLogP | 5.57 |
| TPSA | 141.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.30 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|