C29H39N3O3 — CID 172741204
3-[11,11-bis(3-aminophenoxy)undecan-3-yloxy]aniline (PubChem CID 172741204) has the molecular formula C29H39N3O3 and a molecular weight of 477.65 g/mol. Its IUPAC name is 3-[11,11-bis(3-aminophenoxy)undecan-3-yloxy]aniline.
| Compound Name | 3-[11,11-bis(3-aminophenoxy)undecan-3-yloxy]aniline |
|---|---|
| PubChem CID | 172741204 |
| Molecular Formula | C29H39N3O3 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.30 |
| IUPAC Name | 3-[11,11-bis(3-aminophenoxy)undecan-3-yloxy]aniline |
| SMILES | CCC(CCCCCCCC(Oc1cccc(N)c1)Oc1cccc(N)c1)Oc1cccc(N)c1 |
| InChI | InChI=1S/C29H39N3O3/c1-2-25(33-26-15-8-11-22(30)19-26)14-6-4-3-5-7-18-29(34-27-16-9-12-23(31)20-27)35-28-17-10-13-24(32)21-28/h8-13,15-17,19-21,25,29H,2-7,14,18,30-32H2,1H3 |
| InChIKey | JCYANNWACUHZFH-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 105.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|