About [1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl] propanoate
[1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl] propanoate (PubChem CID 172741267) has the molecular formula C10H11F3O2
and a molecular weight of 220.19 g/mol. Its IUPAC name is [1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl] propanoate.
Molecular Properties
| Compound Name | [1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl] propanoate |
| PubChem CID | 172741267 |
| Molecular Formula | C10H11F3O2 |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | [1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl] propanoate |
| SMILES | CCC(=O)OC1(C(F)(F)F)C=CC=CC1 |
| InChI | InChI=1S/C10H11F3O2/c1-2-8(14)15-9(10(11,12)13)6-4-3-5-7-9/h3-6H,2,7H2,1H3 |
| InChIKey | IZIHTAJXSAUUBB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl] propanoate?
The IUPAC name of [1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl] propanoate (CID 172741267) is [1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl] propanoate.
What is the SMILES notation for [1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl] propanoate?
The canonical SMILES for [1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl] propanoate is CCC(=O)OC1(C(F)(F)F)C=CC=CC1.
What is the InChIKey of [1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl] propanoate?
The InChIKey is IZIHTAJXSAUUBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F3O2/c1-2-8(14)15-9(10(11,12)13)6-4-3-5-7-9/h3-6H,2,7H2,1H3.
What are the key properties of [1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl] propanoate?
[1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl] propanoate has a molecular weight of 220.19 g/mol, XLogP of 2.76, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl] propanoate is sourced from PubChem (CID 172741267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).