C15H10Cl4O — CID 172741718
1,3-dichloro-1,3-bis(2-chlorophenyl)propan-2-one (PubChem CID 172741718) has the molecular formula C15H10Cl4O and a molecular weight of 348.06 g/mol. Its IUPAC name is 1,3-dichloro-1,3-bis(2-chlorophenyl)propan-2-one.
| Compound Name | 1,3-dichloro-1,3-bis(2-chlorophenyl)propan-2-one |
|---|---|
| PubChem CID | 172741718 |
| Molecular Formula | C15H10Cl4O |
| Molecular Weight | 348.06 g/mol |
| Exact Mass | 345.95 |
| IUPAC Name | 1,3-dichloro-1,3-bis(2-chlorophenyl)propan-2-one |
| SMILES | O=C(C(Cl)c1ccccc1Cl)C(Cl)c1ccccc1Cl |
| InChI | InChI=1S/C15H10Cl4O/c16-11-7-3-1-5-9(11)13(18)15(20)14(19)10-6-2-4-8-12(10)17/h1-8,13-14H |
| InChIKey | JELYNOYUUWQZGM-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.06 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|