About 1-phenyl-6-(trifluoromethoxy)-7-thiabicyclo[4.1.0]hepta-2,4-diene
1-phenyl-6-(trifluoromethoxy)-7-thiabicyclo[4.1.0]hepta-2,4-diene (PubChem CID 172742102) has the molecular formula C13H9F3OS
and a molecular weight of 270.28 g/mol. Its IUPAC name is 1-phenyl-6-(trifluoromethoxy)-7-thiabicyclo[4.1.0]hepta-2,4-diene.
Molecular Properties
| Compound Name | 1-phenyl-6-(trifluoromethoxy)-7-thiabicyclo[4.1.0]hepta-2,4-diene |
| PubChem CID | 172742102 |
| Molecular Formula | C13H9F3OS |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 1-phenyl-6-(trifluoromethoxy)-7-thiabicyclo[4.1.0]hepta-2,4-diene |
| SMILES | FC(F)(F)OC12C=CC=CC1(c1ccccc1)S2 |
| InChI | InChI=1S/C13H9F3OS/c14-13(15,16)17-12-9-5-4-8-11(12,18-12)10-6-2-1-3-7-10/h1-9H |
| InChIKey | JFWJXJLNGZLPQY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-phenyl-6-(trifluoromethoxy)-7-thiabicyclo[4.1.0]hepta-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-6-(trifluoromethoxy)-7-thiabicyclo[4.1.0]hepta-2,4-diene?
The IUPAC name of 1-phenyl-6-(trifluoromethoxy)-7-thiabicyclo[4.1.0]hepta-2,4-diene (CID 172742102) is 1-phenyl-6-(trifluoromethoxy)-7-thiabicyclo[4.1.0]hepta-2,4-diene.
What is the SMILES notation for 1-phenyl-6-(trifluoromethoxy)-7-thiabicyclo[4.1.0]hepta-2,4-diene?
The canonical SMILES for 1-phenyl-6-(trifluoromethoxy)-7-thiabicyclo[4.1.0]hepta-2,4-diene is FC(F)(F)OC12C=CC=CC1(c1ccccc1)S2.
What is the InChIKey of 1-phenyl-6-(trifluoromethoxy)-7-thiabicyclo[4.1.0]hepta-2,4-diene?
The InChIKey is JFWJXJLNGZLPQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9F3OS/c14-13(15,16)17-12-9-5-4-8-11(12,18-12)10-6-2-1-3-7-10/h1-9H.
What are the key properties of 1-phenyl-6-(trifluoromethoxy)-7-thiabicyclo[4.1.0]hepta-2,4-diene?
1-phenyl-6-(trifluoromethoxy)-7-thiabicyclo[4.1.0]hepta-2,4-diene has a molecular weight of 270.28 g/mol, XLogP of 3.99, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-6-(trifluoromethoxy)-7-thiabicyclo[4.1.0]hepta-2,4-diene is sourced from PubChem (CID 172742102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).