About bis(2,2,2-trifluoroacetic acid);tri(propan-2-yl)silane;hydrate
bis(2,2,2-trifluoroacetic acid);tri(propan-2-yl)silane;hydrate (PubChem CID 172742353) has the molecular formula C13H26F6O5Si
and a molecular weight of 404.42 g/mol. Its IUPAC name is bis(2,2,2-trifluoroacetic acid);tri(propan-2-yl)silane;hydrate.
Molecular Properties
| Compound Name | bis(2,2,2-trifluoroacetic acid);tri(propan-2-yl)silane;hydrate |
| PubChem CID | 172742353 |
| Molecular Formula | C13H26F6O5Si |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | bis(2,2,2-trifluoroacetic acid);tri(propan-2-yl)silane;hydrate |
| SMILES | CC(C)[SiH](C(C)C)C(C)C.O.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C9H22Si.2C2HF3O2.H2O/c1-7(2)10(8(3)4)9(5)6;2*3-2(4,5)1(6)7;/h7-10H,1-6H3;2*(H,6,7);1H2 |
| InChIKey | JGQQLYTZQYPYOU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 106.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(2,2,2-trifluoroacetic acid);tri(propan-2-yl)silane;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,2,2-trifluoroacetic acid);tri(propan-2-yl)silane;hydrate?
The IUPAC name of bis(2,2,2-trifluoroacetic acid);tri(propan-2-yl)silane;hydrate (CID 172742353) is bis(2,2,2-trifluoroacetic acid);tri(propan-2-yl)silane;hydrate.
What is the SMILES notation for bis(2,2,2-trifluoroacetic acid);tri(propan-2-yl)silane;hydrate?
The canonical SMILES for bis(2,2,2-trifluoroacetic acid);tri(propan-2-yl)silane;hydrate is CC(C)[SiH](C(C)C)C(C)C.O.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.
What is the InChIKey of bis(2,2,2-trifluoroacetic acid);tri(propan-2-yl)silane;hydrate?
The InChIKey is JGQQLYTZQYPYOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22Si.2C2HF3O2.H2O/c1-7(2)10(8(3)4)9(5)6;2*3-2(4,5)1(6)7;/h7-10H,1-6H3;2*(H,6,7);1H2.
What are the key properties of bis(2,2,2-trifluoroacetic acid);tri(propan-2-yl)silane;hydrate?
bis(2,2,2-trifluoroacetic acid);tri(propan-2-yl)silane;hydrate has a molecular weight of 404.42 g/mol, XLogP of 3.89, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,2,2-trifluoroacetic acid);tri(propan-2-yl)silane;hydrate is sourced from PubChem (CID 172742353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).