C18H33NS — CID 172742552
1-(cyclohexylmethyl)-1,2,2,3-tetramethylcyclohexane;isothiocyanic acid (PubChem CID 172742552) has the molecular formula C18H33NS and a molecular weight of 295.54 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-1,2,2,3-tetramethylcyclohexane;isothiocyanic acid.
| Compound Name | 1-(cyclohexylmethyl)-1,2,2,3-tetramethylcyclohexane;isothiocyanic acid |
|---|---|
| PubChem CID | 172742552 |
| Molecular Formula | C18H33NS |
| Molecular Weight | 295.54 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | 1-(cyclohexylmethyl)-1,2,2,3-tetramethylcyclohexane;isothiocyanic acid |
| SMILES | CC1CCCC(C)(CC2CCCCC2)C1(C)C.N=C=S |
| InChI | InChI=1S/C17H32.CHNS/c1-14-9-8-12-17(4,16(14,2)3)13-15-10-6-5-7-11-15;2-1-3/h14-15H,5-13H2,1-4H3;2H |
| InChIKey | JHGGSTDYPJISIA-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.54 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|