C17H29Cl3NO4S3Si+ — CID 172743037
[1-butyl-3-dimethylsilyl-4-oxo-3-[1-(2,2,2-trichloroethoxycarbonyloxy)ethyl]azetidin-2-yl]-dithiocarboxy-ethylsulfanium (PubChem CID 172743037) has the molecular formula C17H29Cl3NO4S3Si+ and a molecular weight of 542.07 g/mol. Its IUPAC name is [1-butyl-3-dimethylsilyl-4-oxo-3-[1-(2,2,2-trichloroethoxycarbonyloxy)ethyl]azetidin-2-yl]-dithiocarboxy-ethylsulfanium.
| Compound Name | [1-butyl-3-dimethylsilyl-4-oxo-3-[1-(2,2,2-trichloroethoxycarbonyloxy)ethyl]azetidin-2-yl]-dithiocarboxy-ethylsulfanium |
|---|---|
| PubChem CID | 172743037 |
| Molecular Formula | C17H29Cl3NO4S3Si+ |
| Molecular Weight | 542.07 g/mol |
| Exact Mass | 540.01 |
| IUPAC Name | [1-butyl-3-dimethylsilyl-4-oxo-3-[1-(2,2,2-trichloroethoxycarbonyloxy)ethyl]azetidin-2-yl]-dithiocarboxy-ethylsulfanium |
| SMILES | CCCCN1C(=O)C(C(C)OC(=O)OCC(Cl)(Cl)Cl)([SiH](C)C)C1[S+](CC)C(=S)S |
| InChI | InChI=1S/C17H28Cl3NO4S3Si/c1-6-8-9-21-12(22)17(29(4)5,13(21)28(7-2)15(26)27)11(3)25-14(23)24-10-16(18,19)20/h11,13,29H,6-10H2,1-5H3/p+1 |
| InChIKey | JITRCNXEOWYYQT-UHFFFAOYSA-O |
| XLogP | 4.95 |
| TPSA | 55.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.07 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|