About dibutyl-(carboxymethyl)-(1,1-difluorobutyl)azanium
dibutyl-(carboxymethyl)-(1,1-difluorobutyl)azanium (PubChem CID 172743144) has the molecular formula C14H28F2NO2+
and a molecular weight of 280.38 g/mol. Its IUPAC name is dibutyl-(carboxymethyl)-(1,1-difluorobutyl)azanium.
Molecular Properties
| Compound Name | dibutyl-(carboxymethyl)-(1,1-difluorobutyl)azanium |
| PubChem CID | 172743144 |
| Molecular Formula | C14H28F2NO2+ |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.21 |
| IUPAC Name | dibutyl-(carboxymethyl)-(1,1-difluorobutyl)azanium |
| SMILES | CCCC[N+](CCCC)(CC(=O)O)C(F)(F)CCC |
| InChI | InChI=1S/C14H27F2NO2/c1-4-7-10-17(11-8-5-2,12-13(18)19)14(15,16)9-6-3/h4-12H2,1-3H3/p+1 |
| InChIKey | LITFOCJMYJEJEZ-UHFFFAOYSA-O |
| XLogP | 3.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze dibutyl-(carboxymethyl)-(1,1-difluorobutyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutyl-(carboxymethyl)-(1,1-difluorobutyl)azanium?
The IUPAC name of dibutyl-(carboxymethyl)-(1,1-difluorobutyl)azanium (CID 172743144) is dibutyl-(carboxymethyl)-(1,1-difluorobutyl)azanium.
What is the SMILES notation for dibutyl-(carboxymethyl)-(1,1-difluorobutyl)azanium?
The canonical SMILES for dibutyl-(carboxymethyl)-(1,1-difluorobutyl)azanium is CCCC[N+](CCCC)(CC(=O)O)C(F)(F)CCC.
What is the InChIKey of dibutyl-(carboxymethyl)-(1,1-difluorobutyl)azanium?
The InChIKey is LITFOCJMYJEJEZ-UHFFFAOYSA-O. The full InChI is InChI=1S/C14H27F2NO2/c1-4-7-10-17(11-8-5-2,12-13(18)19)14(15,16)9-6-3/h4-12H2,1-3H3/p+1.
What are the key properties of dibutyl-(carboxymethyl)-(1,1-difluorobutyl)azanium?
dibutyl-(carboxymethyl)-(1,1-difluorobutyl)azanium has a molecular weight of 280.38 g/mol, XLogP of 3.88, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dibutyl-(carboxymethyl)-(1,1-difluorobutyl)azanium is sourced from PubChem (CID 172743144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).