About azane;3,4,5,5-tetraethylhept-3-ene
azane;3,4,5,5-tetraethylhept-3-ene (PubChem CID 172743775) has the molecular formula C15H36N2
and a molecular weight of 244.47 g/mol. Its IUPAC name is azane;3,4,5,5-tetraethylhept-3-ene.
Molecular Properties
| Compound Name | azane;3,4,5,5-tetraethylhept-3-ene |
| PubChem CID | 172743775 |
| Molecular Formula | C15H36N2 |
| Molecular Weight | 244.47 g/mol |
| Exact Mass | 244.29 |
| IUPAC Name | azane;3,4,5,5-tetraethylhept-3-ene |
| SMILES | CCC(CC)=C(CC)C(CC)(CC)CC.N.N |
| InChI | InChI=1S/C15H30.2H3N/c1-7-13(8-2)14(9-3)15(10-4,11-5)12-6;;/h7-12H2,1-6H3;2*1H3 |
| InChIKey | JLFVMBBNTUNESQ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 244.47 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze azane;3,4,5,5-tetraethylhept-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;3,4,5,5-tetraethylhept-3-ene?
The IUPAC name of azane;3,4,5,5-tetraethylhept-3-ene (CID 172743775) is azane;3,4,5,5-tetraethylhept-3-ene.
What is the SMILES notation for azane;3,4,5,5-tetraethylhept-3-ene?
The canonical SMILES for azane;3,4,5,5-tetraethylhept-3-ene is CCC(CC)=C(CC)C(CC)(CC)CC.N.N.
What is the InChIKey of azane;3,4,5,5-tetraethylhept-3-ene?
The InChIKey is JLFVMBBNTUNESQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30.2H3N/c1-7-13(8-2)14(9-3)15(10-4,11-5)12-6;;/h7-12H2,1-6H3;2*1H3.
What are the key properties of azane;3,4,5,5-tetraethylhept-3-ene?
azane;3,4,5,5-tetraethylhept-3-ene has a molecular weight of 244.47 g/mol, XLogP of 6.05, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;3,4,5,5-tetraethylhept-3-ene is sourced from PubChem (CID 172743775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).