About 1-(2,2,2-trifluoroethyl)-4H-pyridine-3-carboxamide;hydrate
1-(2,2,2-trifluoroethyl)-4H-pyridine-3-carboxamide;hydrate (PubChem CID 172744501) has the molecular formula C8H11F3N2O2
and a molecular weight of 224.18 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethyl)-4H-pyridine-3-carboxamide;hydrate.
Molecular Properties
| Compound Name | 1-(2,2,2-trifluoroethyl)-4H-pyridine-3-carboxamide;hydrate |
| PubChem CID | 172744501 |
| Molecular Formula | C8H11F3N2O2 |
| Molecular Weight | 224.18 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 1-(2,2,2-trifluoroethyl)-4H-pyridine-3-carboxamide;hydrate |
| SMILES | NC(=O)C1=CN(CC(F)(F)F)C=CC1.O |
| InChI | InChI=1S/C8H9F3N2O.H2O/c9-8(10,11)5-13-3-1-2-6(4-13)7(12)14;/h1,3-4H,2,5H2,(H2,12,14);1H2 |
| InChIKey | CSNZLGAELDNRPC-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.18 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2,2,2-trifluoroethyl)-4H-pyridine-3-carboxamide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2,2-trifluoroethyl)-4H-pyridine-3-carboxamide;hydrate?
The IUPAC name of 1-(2,2,2-trifluoroethyl)-4H-pyridine-3-carboxamide;hydrate (CID 172744501) is 1-(2,2,2-trifluoroethyl)-4H-pyridine-3-carboxamide;hydrate.
What is the SMILES notation for 1-(2,2,2-trifluoroethyl)-4H-pyridine-3-carboxamide;hydrate?
The canonical SMILES for 1-(2,2,2-trifluoroethyl)-4H-pyridine-3-carboxamide;hydrate is NC(=O)C1=CN(CC(F)(F)F)C=CC1.O.
What is the InChIKey of 1-(2,2,2-trifluoroethyl)-4H-pyridine-3-carboxamide;hydrate?
The InChIKey is CSNZLGAELDNRPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3N2O.H2O/c9-8(10,11)5-13-3-1-2-6(4-13)7(12)14;/h1,3-4H,2,5H2,(H2,12,14);1H2.
What are the key properties of 1-(2,2,2-trifluoroethyl)-4H-pyridine-3-carboxamide;hydrate?
1-(2,2,2-trifluoroethyl)-4H-pyridine-3-carboxamide;hydrate has a molecular weight of 224.18 g/mol, XLogP of 0.31, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2,2-trifluoroethyl)-4H-pyridine-3-carboxamide;hydrate is sourced from PubChem (CID 172744501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).