C15H24O2 — CID 172745121
1-(1-methoxy-2,3,6-trimethylcyclohexa-2,5-dien-1-yl)pentan-1-one (PubChem CID 172745121) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is 1-(1-methoxy-2,3,6-trimethylcyclohexa-2,5-dien-1-yl)pentan-1-one.
| Compound Name | 1-(1-methoxy-2,3,6-trimethylcyclohexa-2,5-dien-1-yl)pentan-1-one |
|---|---|
| PubChem CID | 172745121 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 1-(1-methoxy-2,3,6-trimethylcyclohexa-2,5-dien-1-yl)pentan-1-one |
| SMILES | CCCCC(=O)C1(OC)C(C)=CCC(C)=C1C |
| InChI | InChI=1S/C15H24O2/c1-6-7-8-14(16)15(17-5)12(3)10-9-11(2)13(15)4/h10H,6-9H2,1-5H3 |
| InChIKey | JPRJYCXMHOMBBG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|