C8H15N3O13P3S+ — CID 172745560
[[(2S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxy-1,3-oxathiolan-3-ium-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 172745560) has the molecular formula C8H15N3O13P3S+ and a molecular weight of 486.21 g/mol. Its IUPAC name is [[(2S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxy-1,3-oxathiolan-3-ium-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxy-1,3-oxathiolan-3-ium-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 172745560 |
| Molecular Formula | C8H15N3O13P3S+ |
| Molecular Weight | 486.21 g/mol |
| Exact Mass | 485.95 |
| IUPAC Name | [[(2S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxy-1,3-oxathiolan-3-ium-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Nc1ccn([C@H]2C[S+](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c(=O)n1 |
| InChI | InChI=1S/C8H14N3O13P3S/c9-5-1-2-11(8(12)10-5)6-4-28(20)7(22-6)3-21-26(16,17)24-27(18,19)23-25(13,14)15/h1-2,6-7,20H,3-4H2,(H5-,9,10,12,13,14,15,16,17,18,19)/p+1/t6-,7+,28?/m1/s1 |
| InChIKey | JRCNIDQIPVTKEV-PDOAOVNKSA-O |
| XLogP | -0.88 |
| TPSA | 250.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.21 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|