C13H16Br2N2O — CID 172745919
trans-(1S,4S)-4-amino-2-[(2-amino-3,5-dibromophenyl)methylidene]cyclohexan-1-ol (PubChem CID 172745919) has the molecular formula C13H16Br2N2O and a molecular weight of 376.09 g/mol. Its IUPAC name is trans-(1S,4S)-4-amino-2-[(2-amino-3,5-dibromophenyl)methylidene]cyclohexan-1-ol.
| Compound Name | trans-(1S,4S)-4-amino-2-[(2-amino-3,5-dibromophenyl)methylidene]cyclohexan-1-ol |
|---|---|
| PubChem CID | 172745919 |
| Molecular Formula | C13H16Br2N2O |
| Molecular Weight | 376.09 g/mol |
| Exact Mass | 373.96 |
| IUPAC Name | trans-(1S,4S)-4-amino-2-[(2-amino-3,5-dibromophenyl)methylidene]cyclohexan-1-ol |
| SMILES | Nc1c(Br)cc(Br)cc1C=C1C[C@@H](N)CC[C@@H]1O |
| InChI | InChI=1S/C13H16Br2N2O/c14-9-4-8(13(17)11(15)6-9)3-7-5-10(16)1-2-12(7)18/h3-4,6,10,12,18H,1-2,5,16-17H2/t10-,12-/m0/s1 |
| InChIKey | JSIFFUCFINGPOY-JQWIXIFHSA-N |
| XLogP | 3.05 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.09 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|