About 4-bromo-1,1,2-trifluorobut-1-ene;hydrobromide
4-bromo-1,1,2-trifluorobut-1-ene;hydrobromide (PubChem CID 172745948) has the molecular formula C4H5Br2F3
and a molecular weight of 269.89 g/mol. Its IUPAC name is 4-bromo-1,1,2-trifluorobut-1-ene;hydrobromide.
Molecular Properties
| Compound Name | 4-bromo-1,1,2-trifluorobut-1-ene;hydrobromide |
| PubChem CID | 172745948 |
| Molecular Formula | C4H5Br2F3 |
| Molecular Weight | 269.89 g/mol |
| Exact Mass | 267.87 |
| IUPAC Name | 4-bromo-1,1,2-trifluorobut-1-ene;hydrobromide |
| SMILES | Br.FC(F)=C(F)CCBr |
| InChI | InChI=1S/C4H4BrF3.BrH/c5-2-1-3(6)4(7)8;/h1-2H2;1H |
| InChIKey | JSKXQUQGALNVLE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.89 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-1,1,2-trifluorobut-1-ene;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1,1,2-trifluorobut-1-ene;hydrobromide?
The IUPAC name of 4-bromo-1,1,2-trifluorobut-1-ene;hydrobromide (CID 172745948) is 4-bromo-1,1,2-trifluorobut-1-ene;hydrobromide.
What is the SMILES notation for 4-bromo-1,1,2-trifluorobut-1-ene;hydrobromide?
The canonical SMILES for 4-bromo-1,1,2-trifluorobut-1-ene;hydrobromide is Br.FC(F)=C(F)CCBr.
What is the InChIKey of 4-bromo-1,1,2-trifluorobut-1-ene;hydrobromide?
The InChIKey is JSKXQUQGALNVLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4BrF3.BrH/c5-2-1-3(6)4(7)8;/h1-2H2;1H.
What are the key properties of 4-bromo-1,1,2-trifluorobut-1-ene;hydrobromide?
4-bromo-1,1,2-trifluorobut-1-ene;hydrobromide has a molecular weight of 269.89 g/mol, XLogP of 3.43, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1,1,2-trifluorobut-1-ene;hydrobromide is sourced from PubChem (CID 172745948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).