About 1,3-dibromo-2-deuterio-21,23-dihydro-2H-porphyrin
1,3-dibromo-2-deuterio-21,23-dihydro-2H-porphyrin (PubChem CID 172746201) has the molecular formula C20H14Br2N4
and a molecular weight of 471.17 g/mol. Its IUPAC name is 1,3-dibromo-2-deuterio-21,23-dihydro-2H-porphyrin.
Molecular Properties
| Compound Name | 1,3-dibromo-2-deuterio-21,23-dihydro-2H-porphyrin |
| PubChem CID | 172746201 |
| Molecular Formula | C20H14Br2N4 |
| Molecular Weight | 471.17 g/mol |
| Exact Mass | 468.96 |
| IUPAC Name | 1,3-dibromo-2-deuterio-21,23-dihydro-2H-porphyrin |
| SMILES | [2H]C1C(Br)=C2C=C3C=CC(=N3)C=c3ccc([nH]3)=CC3=NC(=CC1(Br)N2)C=C3 |
| InChI | InChI=1S/C20H14Br2N4/c21-18-11-20(22)10-17-6-5-15(25-17)8-13-2-1-12(23-13)7-14-3-4-16(24-14)9-19(18)26-20/h1-10,23,26H,11H2/i11D |
| InChIKey | JTJQJHANBAJBQA-WORMITQPSA-N |
| XLogP | 3.07 |
| TPSA | 52.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.17 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dibromo-2-deuterio-21,23-dihydro-2H-porphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dibromo-2-deuterio-21,23-dihydro-2H-porphyrin?
The IUPAC name of 1,3-dibromo-2-deuterio-21,23-dihydro-2H-porphyrin (CID 172746201) is 1,3-dibromo-2-deuterio-21,23-dihydro-2H-porphyrin.
What is the SMILES notation for 1,3-dibromo-2-deuterio-21,23-dihydro-2H-porphyrin?
The canonical SMILES for 1,3-dibromo-2-deuterio-21,23-dihydro-2H-porphyrin is [2H]C1C(Br)=C2C=C3C=CC(=N3)C=c3ccc([nH]3)=CC3=NC(=CC1(Br)N2)C=C3.
What is the InChIKey of 1,3-dibromo-2-deuterio-21,23-dihydro-2H-porphyrin?
The InChIKey is JTJQJHANBAJBQA-WORMITQPSA-N. The full InChI is InChI=1S/C20H14Br2N4/c21-18-11-20(22)10-17-6-5-15(25-17)8-13-2-1-12(23-13)7-14-3-4-16(24-14)9-19(18)26-20/h1-10,23,26H,11H2/i11D.
What are the key properties of 1,3-dibromo-2-deuterio-21,23-dihydro-2H-porphyrin?
1,3-dibromo-2-deuterio-21,23-dihydro-2H-porphyrin has a molecular weight of 471.17 g/mol, XLogP of 3.07, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dibromo-2-deuterio-21,23-dihydro-2H-porphyrin is sourced from PubChem (CID 172746201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).