C10H17NO — CID 172746832
(4S)-4-[(E)-2-cyclopropylethenyl]-2,2-dimethyl-1,3-oxazolidine (PubChem CID 172746832) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is (4S)-4-[(E)-2-cyclopropylethenyl]-2,2-dimethyl-1,3-oxazolidine.
| Compound Name | (4S)-4-[(E)-2-cyclopropylethenyl]-2,2-dimethyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 172746832 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (4S)-4-[(E)-2-cyclopropylethenyl]-2,2-dimethyl-1,3-oxazolidine |
| SMILES | CC1(C)N[C@@H](/C=C/C2CC2)CO1 |
| InChI | InChI=1S/C10H17NO/c1-10(2)11-9(7-12-10)6-5-8-3-4-8/h5-6,8-9,11H,3-4,7H2,1-2H3/b6-5+/t9-/m0/s1 |
| InChIKey | JVKRDPAPRRECFL-CYNONHLPSA-N |
| XLogP | 1.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|