About phenyl-[5-[4-(2-phenylphenyl)phenyl]thiophen-3-yl]methanone;sulfane
phenyl-[5-[4-(2-phenylphenyl)phenyl]thiophen-3-yl]methanone;sulfane (PubChem CID 172747711) has the molecular formula C29H22OS2
and a molecular weight of 450.63 g/mol. Its IUPAC name is phenyl-[5-[4-(2-phenylphenyl)phenyl]thiophen-3-yl]methanone;sulfane.
Molecular Properties
| Compound Name | phenyl-[5-[4-(2-phenylphenyl)phenyl]thiophen-3-yl]methanone;sulfane |
| PubChem CID | 172747711 |
| Molecular Formula | C29H22OS2 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | phenyl-[5-[4-(2-phenylphenyl)phenyl]thiophen-3-yl]methanone;sulfane |
| SMILES | O=C(c1ccccc1)c1csc(-c2ccc(-c3ccccc3-c3ccccc3)cc2)c1.S |
| InChI | InChI=1S/C29H20OS.H2S/c30-29(24-11-5-2-6-12-24)25-19-28(31-20-25)23-17-15-22(16-18-23)27-14-8-7-13-26(27)21-9-3-1-4-10-21;/h1-20H;1H2 |
| InChIKey | JYIHHPAPFYHETP-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze phenyl-[5-[4-(2-phenylphenyl)phenyl]thiophen-3-yl]methanone;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl-[5-[4-(2-phenylphenyl)phenyl]thiophen-3-yl]methanone;sulfane?
The IUPAC name of phenyl-[5-[4-(2-phenylphenyl)phenyl]thiophen-3-yl]methanone;sulfane (CID 172747711) is phenyl-[5-[4-(2-phenylphenyl)phenyl]thiophen-3-yl]methanone;sulfane.
What is the SMILES notation for phenyl-[5-[4-(2-phenylphenyl)phenyl]thiophen-3-yl]methanone;sulfane?
The canonical SMILES for phenyl-[5-[4-(2-phenylphenyl)phenyl]thiophen-3-yl]methanone;sulfane is O=C(c1ccccc1)c1csc(-c2ccc(-c3ccccc3-c3ccccc3)cc2)c1.S.
What is the InChIKey of phenyl-[5-[4-(2-phenylphenyl)phenyl]thiophen-3-yl]methanone;sulfane?
The InChIKey is JYIHHPAPFYHETP-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H20OS.H2S/c30-29(24-11-5-2-6-12-24)25-19-28(31-20-25)23-17-15-22(16-18-23)27-14-8-7-13-26(27)21-9-3-1-4-10-21;/h1-20H;1H2.
What are the key properties of phenyl-[5-[4-(2-phenylphenyl)phenyl]thiophen-3-yl]methanone;sulfane?
phenyl-[5-[4-(2-phenylphenyl)phenyl]thiophen-3-yl]methanone;sulfane has a molecular weight of 450.63 g/mol, XLogP of 8.09, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl-[5-[4-(2-phenylphenyl)phenyl]thiophen-3-yl]methanone;sulfane is sourced from PubChem (CID 172747711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).