C23H26ClFN4O3 — CID 172750082
(11R)-7-chloro-6-(2-fluorophenyl)-4-(4-hydroxy-2,2-dimethylpyrrolidin-1-yl)-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one (PubChem CID 172750082) has the molecular formula C23H26ClFN4O3 and a molecular weight of 460.94 g/mol. Its IUPAC name is (11R)-7-chloro-6-(2-fluorophenyl)-4-(4-hydroxy-2,2-dimethylpyrrolidin-1-yl)-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one.
| Compound Name | (11R)-7-chloro-6-(2-fluorophenyl)-4-(4-hydroxy-2,2-dimethylpyrrolidin-1-yl)-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one |
|---|---|
| PubChem CID | 172750082 |
| Molecular Formula | C23H26ClFN4O3 |
| Molecular Weight | 460.94 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | (11R)-7-chloro-6-(2-fluorophenyl)-4-(4-hydroxy-2,2-dimethylpyrrolidin-1-yl)-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one |
| SMILES | CC1(C)CC(O)CN1c1nc(-c2ccccc2F)c(Cl)c2c1C(=O)N1CCNC[C@@H]1CO2 |
| InChI | InChI=1S/C23H26ClFN4O3/c1-23(2)9-14(30)11-29(23)21-17-20(32-12-13-10-26-7-8-28(13)22(17)31)18(24)19(27-21)15-5-3-4-6-16(15)25/h3-6,13-14,26,30H,7-12H2,1-2H3/t13-,14?/m1/s1 |
| InChIKey | KGDQXPWXKFMTEY-KWCCSABGSA-N |
| XLogP | 2.70 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.94 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |