About diethylazanide;5-methylcyclopenta-1,3-diene;titanium(2+)
diethylazanide;5-methylcyclopenta-1,3-diene;titanium(2+) (PubChem CID 172750424) has the molecular formula C10H17NTi
and a molecular weight of 199.12 g/mol. Its IUPAC name is diethylazanide;5-methylcyclopenta-1,3-diene;titanium(2+).
Molecular Properties
| Compound Name | diethylazanide;5-methylcyclopenta-1,3-diene;titanium(2+) |
| PubChem CID | 172750424 |
| Molecular Formula | C10H17NTi |
| Molecular Weight | 199.12 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | diethylazanide;5-methylcyclopenta-1,3-diene;titanium(2+) |
| SMILES | CC[N-]CC.C[c-]1cccc1.[Ti+2] |
| InChI | InChI=1S/C6H7.C4H10N.Ti/c1-6-4-2-3-5-6;1-3-5-4-2;/h2-5H,1H3;3-4H2,1-2H3;/q2*-1;+2 |
| InChIKey | QAHPTRWEPVIICK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.12 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze diethylazanide;5-methylcyclopenta-1,3-diene;titanium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethylazanide;5-methylcyclopenta-1,3-diene;titanium(2+)?
The IUPAC name of diethylazanide;5-methylcyclopenta-1,3-diene;titanium(2+) (CID 172750424) is diethylazanide;5-methylcyclopenta-1,3-diene;titanium(2+).
What is the SMILES notation for diethylazanide;5-methylcyclopenta-1,3-diene;titanium(2+)?
The canonical SMILES for diethylazanide;5-methylcyclopenta-1,3-diene;titanium(2+) is CC[N-]CC.C[c-]1cccc1.[Ti+2].
What is the InChIKey of diethylazanide;5-methylcyclopenta-1,3-diene;titanium(2+)?
The InChIKey is QAHPTRWEPVIICK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7.C4H10N.Ti/c1-6-4-2-3-5-6;1-3-5-4-2;/h2-5H,1H3;3-4H2,1-2H3;/q2*-1;+2.
What are the key properties of diethylazanide;5-methylcyclopenta-1,3-diene;titanium(2+)?
diethylazanide;5-methylcyclopenta-1,3-diene;titanium(2+) has a molecular weight of 199.12 g/mol, XLogP of 3.11, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diethylazanide;5-methylcyclopenta-1,3-diene;titanium(2+) is sourced from PubChem (CID 172750424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).