C10H24N2O2Si — CID 172751095
2,2-dimethoxyethyl(3-imidazolidin-1-ylpropyl)silane (PubChem CID 172751095) has the molecular formula C10H24N2O2Si and a molecular weight of 232.40 g/mol. Its IUPAC name is 2,2-dimethoxyethyl(3-imidazolidin-1-ylpropyl)silane.
| Compound Name | 2,2-dimethoxyethyl(3-imidazolidin-1-ylpropyl)silane |
|---|---|
| PubChem CID | 172751095 |
| Molecular Formula | C10H24N2O2Si |
| Molecular Weight | 232.40 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 2,2-dimethoxyethyl(3-imidazolidin-1-ylpropyl)silane |
| SMILES | COC(C[SiH2]CCCN1CCNC1)OC |
| InChI | InChI=1S/C10H24N2O2Si/c1-13-10(14-2)8-15-7-3-5-12-6-4-11-9-12/h10-11H,3-9,15H2,1-2H3 |
| InChIKey | KJPHQTMRRXNAIY-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.40 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|