About azane;5-nitro-1H-1,2,4-triazole
azane;5-nitro-1H-1,2,4-triazole (PubChem CID 172751098) has the molecular formula C2H5N5O2
and a molecular weight of 131.10 g/mol. Its IUPAC name is azane;5-nitro-1H-1,2,4-triazole.
Molecular Properties
| Compound Name | azane;5-nitro-1H-1,2,4-triazole |
| PubChem CID | 172751098 |
| Molecular Formula | C2H5N5O2 |
| Molecular Weight | 131.10 g/mol |
| Exact Mass | 131.04 |
| IUPAC Name | azane;5-nitro-1H-1,2,4-triazole |
| SMILES | N.O=[N+]([O-])c1ncn[nH]1 |
| InChI | InChI=1S/C2H2N4O2.H3N/c7-6(8)2-3-1-4-5-2;/h1H,(H,3,4,5);1H3 |
| InChIKey | KJPQFMQFUIIISF-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 119.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.10 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azane;5-nitro-1H-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;5-nitro-1H-1,2,4-triazole?
The IUPAC name of azane;5-nitro-1H-1,2,4-triazole (CID 172751098) is azane;5-nitro-1H-1,2,4-triazole.
What is the SMILES notation for azane;5-nitro-1H-1,2,4-triazole?
The canonical SMILES for azane;5-nitro-1H-1,2,4-triazole is N.O=[N+]([O-])c1ncn[nH]1.
What is the InChIKey of azane;5-nitro-1H-1,2,4-triazole?
The InChIKey is KJPQFMQFUIIISF-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2N4O2.H3N/c7-6(8)2-3-1-4-5-2;/h1H,(H,3,4,5);1H3.
What are the key properties of azane;5-nitro-1H-1,2,4-triazole?
azane;5-nitro-1H-1,2,4-triazole has a molecular weight of 131.10 g/mol, XLogP of -0.13, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;5-nitro-1H-1,2,4-triazole is sourced from PubChem (CID 172751098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).