About 5-(1,2-oxazol-3-yl)-1H-pyrimidine-2,4-dione
5-(1,2-oxazol-3-yl)-1H-pyrimidine-2,4-dione (PubChem CID 172751963) has the molecular formula C7H5N3O3
and a molecular weight of 179.14 g/mol. Its IUPAC name is 5-(1,2-oxazol-3-yl)-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5-(1,2-oxazol-3-yl)-1H-pyrimidine-2,4-dione |
| PubChem CID | 172751963 |
| Molecular Formula | C7H5N3O3 |
| Molecular Weight | 179.14 g/mol |
| Exact Mass | 179.03 |
| IUPAC Name | 5-(1,2-oxazol-3-yl)-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]cc(-c2ccon2)c(=O)[nH]1 |
| InChI | InChI=1S/C7H5N3O3/c11-6-4(3-8-7(12)9-6)5-1-2-13-10-5/h1-3H,(H2,8,9,11,12) |
| InChIKey | KMMJMHWYCHGLNX-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.14 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(1,2-oxazol-3-yl)-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,2-oxazol-3-yl)-1H-pyrimidine-2,4-dione?
The IUPAC name of 5-(1,2-oxazol-3-yl)-1H-pyrimidine-2,4-dione (CID 172751963) is 5-(1,2-oxazol-3-yl)-1H-pyrimidine-2,4-dione.
What is the SMILES notation for 5-(1,2-oxazol-3-yl)-1H-pyrimidine-2,4-dione?
The canonical SMILES for 5-(1,2-oxazol-3-yl)-1H-pyrimidine-2,4-dione is O=c1[nH]cc(-c2ccon2)c(=O)[nH]1.
What is the InChIKey of 5-(1,2-oxazol-3-yl)-1H-pyrimidine-2,4-dione?
The InChIKey is KMMJMHWYCHGLNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O3/c11-6-4(3-8-7(12)9-6)5-1-2-13-10-5/h1-3H,(H2,8,9,11,12).
What are the key properties of 5-(1,2-oxazol-3-yl)-1H-pyrimidine-2,4-dione?
5-(1,2-oxazol-3-yl)-1H-pyrimidine-2,4-dione has a molecular weight of 179.14 g/mol, XLogP of -0.28, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,2-oxazol-3-yl)-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 172751963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).