About [5-(3,4-dihydrophthalazin-1-ylmethyl)-2-fluorophenyl]-piperazin-2-ylmethanone
[5-(3,4-dihydrophthalazin-1-ylmethyl)-2-fluorophenyl]-piperazin-2-ylmethanone (PubChem CID 172753579) has the molecular formula C20H21FN4O
and a molecular weight of 352.41 g/mol. Its IUPAC name is [5-(3,4-dihydrophthalazin-1-ylmethyl)-2-fluorophenyl]-piperazin-2-ylmethanone.
Molecular Properties
| Compound Name | [5-(3,4-dihydrophthalazin-1-ylmethyl)-2-fluorophenyl]-piperazin-2-ylmethanone |
| PubChem CID | 172753579 |
| Molecular Formula | C20H21FN4O |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | [5-(3,4-dihydrophthalazin-1-ylmethyl)-2-fluorophenyl]-piperazin-2-ylmethanone |
| SMILES | O=C(c1cc(CC2=NNCc3ccccc32)ccc1F)C1CNCCN1 |
| InChI | InChI=1S/C20H21FN4O/c21-17-6-5-13(9-16(17)20(26)19-12-22-7-8-23-19)10-18-15-4-2-1-3-14(15)11-24-25-18/h1-6,9,19,22-24H,7-8,10-12H2 |
| InChIKey | KSEFSSHJNXBJBN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-(3,4-dihydrophthalazin-1-ylmethyl)-2-fluorophenyl]-piperazin-2-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(3,4-dihydrophthalazin-1-ylmethyl)-2-fluorophenyl]-piperazin-2-ylmethanone?
The IUPAC name of [5-(3,4-dihydrophthalazin-1-ylmethyl)-2-fluorophenyl]-piperazin-2-ylmethanone (CID 172753579) is [5-(3,4-dihydrophthalazin-1-ylmethyl)-2-fluorophenyl]-piperazin-2-ylmethanone.
What is the SMILES notation for [5-(3,4-dihydrophthalazin-1-ylmethyl)-2-fluorophenyl]-piperazin-2-ylmethanone?
The canonical SMILES for [5-(3,4-dihydrophthalazin-1-ylmethyl)-2-fluorophenyl]-piperazin-2-ylmethanone is O=C(c1cc(CC2=NNCc3ccccc32)ccc1F)C1CNCCN1.
What is the InChIKey of [5-(3,4-dihydrophthalazin-1-ylmethyl)-2-fluorophenyl]-piperazin-2-ylmethanone?
The InChIKey is KSEFSSHJNXBJBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21FN4O/c21-17-6-5-13(9-16(17)20(26)19-12-22-7-8-23-19)10-18-15-4-2-1-3-14(15)11-24-25-18/h1-6,9,19,22-24H,7-8,10-12H2.
What are the key properties of [5-(3,4-dihydrophthalazin-1-ylmethyl)-2-fluorophenyl]-piperazin-2-ylmethanone?
[5-(3,4-dihydrophthalazin-1-ylmethyl)-2-fluorophenyl]-piperazin-2-ylmethanone has a molecular weight of 352.41 g/mol, XLogP of 1.62, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(3,4-dihydrophthalazin-1-ylmethyl)-2-fluorophenyl]-piperazin-2-ylmethanone is sourced from PubChem (CID 172753579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).