C19H20ClN3O4 — CID 172753720
5-[(1R)-2-[(4-amino-5-chloro-2-methoxyphenyl)methylamino]-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one (PubChem CID 172753720) has the molecular formula C19H20ClN3O4 and a molecular weight of 389.84 g/mol. Its IUPAC name is 5-[(1R)-2-[(4-amino-5-chloro-2-methoxyphenyl)methylamino]-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one.
| Compound Name | 5-[(1R)-2-[(4-amino-5-chloro-2-methoxyphenyl)methylamino]-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 172753720 |
| Molecular Formula | C19H20ClN3O4 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 5-[(1R)-2-[(4-amino-5-chloro-2-methoxyphenyl)methylamino]-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one |
| SMILES | COc1cc(N)c(Cl)cc1CNC[C@H](O)c1ccc(O)c2[nH]c(=O)ccc12 |
| InChI | InChI=1S/C19H20ClN3O4/c1-27-17-7-14(21)13(20)6-10(17)8-22-9-16(25)11-2-4-15(24)19-12(11)3-5-18(26)23-19/h2-7,16,22,24-25H,8-9,21H2,1H3,(H,23,26)/t16-/m0/s1 |
| InChIKey | KSPROSFOPDFQQD-INIZCTEOSA-N |
| XLogP | 2.30 |
| TPSA | 120.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|