C25H27ClFN7O — CID 172754404
2-[4-(4-chloroimidazol-1-yl)-3-methoxyphenyl]-4-ethylimino-8-(4-fluorophenyl)-1,3,5,6,7,8-hexahydropyrido[3,4-d]pyrimidin-2-amine (PubChem CID 172754404) has the molecular formula C25H27ClFN7O and a molecular weight of 495.99 g/mol. Its IUPAC name is 2-[4-(4-chloroimidazol-1-yl)-3-methoxyphenyl]-4-ethylimino-8-(4-fluorophenyl)-1,3,5,6,7,8-hexahydropyrido[3,4-d]pyrimidin-2-amine.
| Compound Name | 2-[4-(4-chloroimidazol-1-yl)-3-methoxyphenyl]-4-ethylimino-8-(4-fluorophenyl)-1,3,5,6,7,8-hexahydropyrido[3,4-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 172754404 |
| Molecular Formula | C25H27ClFN7O |
| Molecular Weight | 495.99 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 2-[4-(4-chloroimidazol-1-yl)-3-methoxyphenyl]-4-ethylimino-8-(4-fluorophenyl)-1,3,5,6,7,8-hexahydropyrido[3,4-d]pyrimidin-2-amine |
| SMILES | CC/N=C1/NC(N)(c2ccc(-n3cnc(Cl)c3)c(OC)c2)NC2=C1CCNC2c1ccc(F)cc1 |
| InChI | InChI=1S/C25H27ClFN7O/c1-3-29-24-18-10-11-30-22(15-4-7-17(27)8-5-15)23(18)32-25(28,33-24)16-6-9-19(20(12-16)35-2)34-13-21(26)31-14-34/h4-9,12-14,22,30,32H,3,10-11,28H2,1-2H3,(H,29,33) |
| InChIKey | KUXOEJXPYJJAST-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 101.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.99 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|