About [1,3]dioxolo[4,5-i][3]benzazepin-9-one;hydrochloride
[1,3]dioxolo[4,5-i][3]benzazepin-9-one;hydrochloride (PubChem CID 172754515) has the molecular formula C11H8ClNO3
and a molecular weight of 237.64 g/mol. Its IUPAC name is [1,3]dioxolo[4,5-i][3]benzazepin-9-one;hydrochloride.
Molecular Properties
| Compound Name | [1,3]dioxolo[4,5-i][3]benzazepin-9-one;hydrochloride |
| PubChem CID | 172754515 |
| Molecular Formula | C11H8ClNO3 |
| Molecular Weight | 237.64 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | [1,3]dioxolo[4,5-i][3]benzazepin-9-one;hydrochloride |
| SMILES | Cl.O=c1cc2c3c(ccc2ccn1)OCO3 |
| InChI | InChI=1S/C11H7NO3.ClH/c13-10-5-8-7(3-4-12-10)1-2-9-11(8)15-6-14-9;/h1-5H,6H2;1H |
| InChIKey | KVGVGCSEZLUOBU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.64 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1,3]dioxolo[4,5-i][3]benzazepin-9-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,3]dioxolo[4,5-i][3]benzazepin-9-one;hydrochloride?
The IUPAC name of [1,3]dioxolo[4,5-i][3]benzazepin-9-one;hydrochloride (CID 172754515) is [1,3]dioxolo[4,5-i][3]benzazepin-9-one;hydrochloride.
What is the SMILES notation for [1,3]dioxolo[4,5-i][3]benzazepin-9-one;hydrochloride?
The canonical SMILES for [1,3]dioxolo[4,5-i][3]benzazepin-9-one;hydrochloride is Cl.O=c1cc2c3c(ccc2ccn1)OCO3.
What is the InChIKey of [1,3]dioxolo[4,5-i][3]benzazepin-9-one;hydrochloride?
The InChIKey is KVGVGCSEZLUOBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7NO3.ClH/c13-10-5-8-7(3-4-12-10)1-2-9-11(8)15-6-14-9;/h1-5H,6H2;1H.
What are the key properties of [1,3]dioxolo[4,5-i][3]benzazepin-9-one;hydrochloride?
[1,3]dioxolo[4,5-i][3]benzazepin-9-one;hydrochloride has a molecular weight of 237.64 g/mol, XLogP of 1.75, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3]dioxolo[4,5-i][3]benzazepin-9-one;hydrochloride is sourced from PubChem (CID 172754515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).