About sodium;5-methyl-2-sulfanylphenol;phenoxide
sodium;5-methyl-2-sulfanylphenol;phenoxide (PubChem CID 172754836) has the molecular formula C13H13NaO2S
and a molecular weight of 256.30 g/mol. Its IUPAC name is sodium;5-methyl-2-sulfanylphenol;phenoxide.
Molecular Properties
| Compound Name | sodium;5-methyl-2-sulfanylphenol;phenoxide |
| PubChem CID | 172754836 |
| Molecular Formula | C13H13NaO2S |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | sodium;5-methyl-2-sulfanylphenol;phenoxide |
| SMILES | Cc1ccc(S)c(O)c1.[Na+].[O-]c1ccccc1 |
| InChI | InChI=1S/C7H8OS.C6H6O.Na/c1-5-2-3-7(9)6(8)4-5;7-6-4-2-1-3-5-6;/h2-4,8-9H,1H3;1-5,7H;/q;;+1/p-1 |
| InChIKey | KWKZEQCJWXVYLJ-UHFFFAOYSA-M |
| XLogP | -0.25 |
| TPSA | 43.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;5-methyl-2-sulfanylphenol;phenoxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;5-methyl-2-sulfanylphenol;phenoxide?
The IUPAC name of sodium;5-methyl-2-sulfanylphenol;phenoxide (CID 172754836) is sodium;5-methyl-2-sulfanylphenol;phenoxide.
What is the SMILES notation for sodium;5-methyl-2-sulfanylphenol;phenoxide?
The canonical SMILES for sodium;5-methyl-2-sulfanylphenol;phenoxide is Cc1ccc(S)c(O)c1.[Na+].[O-]c1ccccc1.
What is the InChIKey of sodium;5-methyl-2-sulfanylphenol;phenoxide?
The InChIKey is KWKZEQCJWXVYLJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8OS.C6H6O.Na/c1-5-2-3-7(9)6(8)4-5;7-6-4-2-1-3-5-6;/h2-4,8-9H,1H3;1-5,7H;/q;;+1/p-1.
What are the key properties of sodium;5-methyl-2-sulfanylphenol;phenoxide?
sodium;5-methyl-2-sulfanylphenol;phenoxide has a molecular weight of 256.30 g/mol, XLogP of -0.25, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;5-methyl-2-sulfanylphenol;phenoxide is sourced from PubChem (CID 172754836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).