C5H19NO4Si4 — CID 172755095
N,2,4,6,8-pentamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-amine (PubChem CID 172755095) has the molecular formula C5H19NO4Si4 and a molecular weight of 269.55 g/mol. Its IUPAC name is N,2,4,6,8-pentamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-amine.
| Compound Name | N,2,4,6,8-pentamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-amine |
|---|---|
| PubChem CID | 172755095 |
| Molecular Formula | C5H19NO4Si4 |
| Molecular Weight | 269.55 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | N,2,4,6,8-pentamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-amine |
| SMILES | CN[Si]1(C)O[SiH](C)O[SiH](C)O[SiH](C)O1 |
| InChI | InChI=1S/C5H19NO4Si4/c1-6-14(5)9-12(3)7-11(2)8-13(4)10-14/h6,11-13H,1-5H3 |
| InChIKey | KXHOBEJWMJXXRM-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.55 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|