C12H18ClN3O2 — CID 172755445
1-(1-methyl-2-oxo-4-pyridinyl)piperidine-3-carboxamide;hydrochloride (PubChem CID 172755445) has the molecular formula C12H18ClN3O2 and a molecular weight of 271.75 g/mol. Its IUPAC name is 1-(1-methyl-2-oxo-4-pyridinyl)piperidine-3-carboxamide;hydrochloride.
| Compound Name | 1-(1-methyl-2-oxo-4-pyridinyl)piperidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 172755445 |
| Molecular Formula | C12H18ClN3O2 |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 1-(1-methyl-2-oxo-4-pyridinyl)piperidine-3-carboxamide;hydrochloride |
| SMILES | Cl.Cn1ccc(N2CCCC(C(N)=O)C2)cc1=O |
| InChI | InChI=1S/C12H17N3O2.ClH/c1-14-6-4-10(7-11(14)16)15-5-2-3-9(8-15)12(13)17;/h4,6-7,9H,2-3,5,8H2,1H3,(H2,13,17);1H |
| InChIKey | KYMSLMAYGOWXLA-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |