C22H18FN3O2S — CID 172755941
(E)-3-[9-(2,1,3-benzothiadiazol-5-ylmethyl)-3-fluoro-5,6,7,8-tetrahydrocarbazol-1-yl]prop-2-enoic acid (PubChem CID 172755941) has the molecular formula C22H18FN3O2S and a molecular weight of 407.47 g/mol. Its IUPAC name is (E)-3-[9-(2,1,3-benzothiadiazol-5-ylmethyl)-3-fluoro-5,6,7,8-tetrahydrocarbazol-1-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[9-(2,1,3-benzothiadiazol-5-ylmethyl)-3-fluoro-5,6,7,8-tetrahydrocarbazol-1-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 172755941 |
| Molecular Formula | C22H18FN3O2S |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | (E)-3-[9-(2,1,3-benzothiadiazol-5-ylmethyl)-3-fluoro-5,6,7,8-tetrahydrocarbazol-1-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc(F)cc2c3c(n(Cc4ccc5nsnc5c4)c12)CCCC3 |
| InChI | InChI=1S/C22H18FN3O2S/c23-15-10-14(6-8-21(27)28)22-17(11-15)16-3-1-2-4-20(16)26(22)12-13-5-7-18-19(9-13)25-29-24-18/h5-11H,1-4,12H2,(H,27,28)/b8-6+ |
| InChIKey | LAHNVSFATARYPM-SOFGYWHQSA-N |
| XLogP | 4.81 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|