C16H13F10NO4S2 — CID 172756898
1-ethylsulfonyl-N-(1-ethylsulfonyl-2,3,4,5,6-pentafluorocyclohexa-2,4-dien-1-yl)-2,3,4,5,6-pentafluorocyclohexa-2,4-dien-1-amine (PubChem CID 172756898) has the molecular formula C16H13F10NO4S2 and a molecular weight of 537.40 g/mol. Its IUPAC name is 1-ethylsulfonyl-N-(1-ethylsulfonyl-2,3,4,5,6-pentafluorocyclohexa-2,4-dien-1-yl)-2,3,4,5,6-pentafluorocyclohexa-2,4-dien-1-amine.
| Compound Name | 1-ethylsulfonyl-N-(1-ethylsulfonyl-2,3,4,5,6-pentafluorocyclohexa-2,4-dien-1-yl)-2,3,4,5,6-pentafluorocyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 172756898 |
| Molecular Formula | C16H13F10NO4S2 |
| Molecular Weight | 537.40 g/mol |
| Exact Mass | 537.01 |
| IUPAC Name | 1-ethylsulfonyl-N-(1-ethylsulfonyl-2,3,4,5,6-pentafluorocyclohexa-2,4-dien-1-yl)-2,3,4,5,6-pentafluorocyclohexa-2,4-dien-1-amine |
| SMILES | CCS(=O)(=O)C1(NC2(S(=O)(=O)CC)C(F)=C(F)C(F)=C(F)C2F)C(F)=C(F)C(F)=C(F)C1F |
| InChI | InChI=1S/C16H13F10NO4S2/c1-3-32(28,29)15(11(23)7(19)5(17)8(20)12(15)24)27-16(33(30,31)4-2)13(25)9(21)6(18)10(22)14(16)26/h11,13,27H,3-4H2,1-2H3 |
| InChIKey | OLINEGKOTULHEJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |