C50H40O12Sb2 — CID 172757368
[4-[[4-bis(4-penta-2,4-dienoyloxyphenoxy)stibanylphenyl]-(4-penta-2,4-dienoyloxyphenoxy)stibanyl]oxyphenyl] penta-2,4-dienoate (PubChem CID 172757368) has the molecular formula C50H40O12Sb2 and a molecular weight of 1076.38 g/mol. Its IUPAC name is [4-[[4-bis(4-penta-2,4-dienoyloxyphenoxy)stibanylphenyl]-(4-penta-2,4-dienoyloxyphenoxy)stibanyl]oxyphenyl] penta-2,4-dienoate.
| Compound Name | [4-[[4-bis(4-penta-2,4-dienoyloxyphenoxy)stibanylphenyl]-(4-penta-2,4-dienoyloxyphenoxy)stibanyl]oxyphenyl] penta-2,4-dienoate |
|---|---|
| PubChem CID | 172757368 |
| Molecular Formula | C50H40O12Sb2 |
| Molecular Weight | 1076.38 g/mol |
| Exact Mass | 1074.06 |
| IUPAC Name | [4-[[4-bis(4-penta-2,4-dienoyloxyphenoxy)stibanylphenyl]-(4-penta-2,4-dienoyloxyphenoxy)stibanyl]oxyphenyl] penta-2,4-dienoate |
| SMILES | C=CC=CC(=O)Oc1ccc(O[Sb](Oc2ccc(OC(=O)C=CC=C)cc2)c2ccc([Sb](Oc3ccc(OC(=O)C=CC=C)cc3)Oc3ccc(OC(=O)C=CC=C)cc3)cc2)cc1 |
| InChI | InChI=1S/4C11H10O3.C6H4.2Sb/c4*1-2-3-4-11(13)14-10-7-5-9(12)6-8-10;1-2-4-6-5-3-1;;/h4*2-8,12H,1H2;1-2,5-6H;;/q;;;;;2*+2/p-4 |
| InChIKey | LFCBFRAHQPRJKY-UHFFFAOYSA-J |
| XLogP | 7.98 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1076.38 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|